C24H29N5O3 — CID 75183280
N-(cyanomethyl)-3-(3,5-dimethylphenyl)-2-[(2-morpholin-4-yl-2-pyridin-4-ylacetyl)amino]propanamide (PubChem CID 75183280) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-(cyanomethyl)-3-(3,5-dimethylphenyl)-2-[(2-morpholin-4-yl-2-pyridin-4-ylacetyl)amino]propanamide.
| Compound Name | N-(cyanomethyl)-3-(3,5-dimethylphenyl)-2-[(2-morpholin-4-yl-2-pyridin-4-ylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 75183280 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-(cyanomethyl)-3-(3,5-dimethylphenyl)-2-[(2-morpholin-4-yl-2-pyridin-4-ylacetyl)amino]propanamide |
| SMILES | Cc1cc(C)cc(CC(NC(=O)C(c2ccncc2)N2CCOCC2)C(=O)NCC#N)c1 |
| InChI | InChI=1S/C24H29N5O3/c1-17-13-18(2)15-19(14-17)16-21(23(30)27-8-5-25)28-24(31)22(20-3-6-26-7-4-20)29-9-11-32-12-10-29/h3-4,6-7,13-15,21-22H,8-12,16H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | JHGUDRRPSQCFFP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|