C25H24N4O2 — CID 10884139
N-(cyanomethyl)-2-[(2,2-diphenylacetyl)amino]-3-(5-methyl-3-pyridinyl)propanamide (PubChem CID 10884139) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[(2,2-diphenylacetyl)amino]-3-(5-methyl-3-pyridinyl)propanamide.
| Compound Name | N-(cyanomethyl)-2-[(2,2-diphenylacetyl)amino]-3-(5-methyl-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 10884139 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-(cyanomethyl)-2-[(2,2-diphenylacetyl)amino]-3-(5-methyl-3-pyridinyl)propanamide |
| SMILES | Cc1cncc(CC(NC(=O)C(c2ccccc2)c2ccccc2)C(=O)NCC#N)c1 |
| InChI | InChI=1S/C25H24N4O2/c1-18-14-19(17-27-16-18)15-22(24(30)28-13-12-26)29-25(31)23(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-11,14,16-17,22-23H,13,15H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | VXTNGEVCOQBVKV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|