C20H25N5O2 — CID 3798221
N-[[4-(dimethylamino)phenyl]methylideneamino]-2-morpholin-4-yl-2-pyridin-4-ylacetamide (PubChem CID 3798221) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methylideneamino]-2-morpholin-4-yl-2-pyridin-4-ylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-2-morpholin-4-yl-2-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 3798221 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-2-morpholin-4-yl-2-pyridin-4-ylacetamide |
| SMILES | CN(C)c1ccc(C=NNC(=O)C(c2ccncc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H25N5O2/c1-24(2)18-5-3-16(4-6-18)15-22-23-20(26)19(17-7-9-21-10-8-17)25-11-13-27-14-12-25/h3-10,15,19H,11-14H2,1-2H3,(H,23,26) |
| InChIKey | CTILFURKWKFVLM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|