C18H18N6O7 — CID 4648875
N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-morpholin-4-yl-2-pyridin-4-ylacetamide (PubChem CID 4648875) has the molecular formula C18H18N6O7 and a molecular weight of 430.38 g/mol. Its IUPAC name is N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-morpholin-4-yl-2-pyridin-4-ylacetamide.
| Compound Name | N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-morpholin-4-yl-2-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 4648875 |
| Molecular Formula | C18H18N6O7 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-morpholin-4-yl-2-pyridin-4-ylacetamide |
| SMILES | O=C(NN=Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O)C(c1ccncc1)N1CCOCC1 |
| InChI | InChI=1S/C18H18N6O7/c25-17-13(9-14(23(27)28)10-15(17)24(29)30)11-20-21-18(26)16(12-1-3-19-4-2-12)22-5-7-31-8-6-22/h1-4,9-11,16,25H,5-8H2,(H,21,26) |
| InChIKey | RQILUSRZDMXLFA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 173.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|