C22H19N5O2 — CID 56678113
N-[1-(cyanomethylamino)-1-oxo-3-(3-pyridazin-4-ylphenyl)propan-2-yl]benzamide (PubChem CID 56678113) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is N-[1-(cyanomethylamino)-1-oxo-3-(3-pyridazin-4-ylphenyl)propan-2-yl]benzamide.
| Compound Name | N-[1-(cyanomethylamino)-1-oxo-3-(3-pyridazin-4-ylphenyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 56678113 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[1-(cyanomethylamino)-1-oxo-3-(3-pyridazin-4-ylphenyl)propan-2-yl]benzamide |
| SMILES | N#CCNC(=O)C(Cc1cccc(-c2ccnnc2)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19N5O2/c23-10-12-24-22(29)20(27-21(28)17-6-2-1-3-7-17)14-16-5-4-8-18(13-16)19-9-11-25-26-15-19/h1-9,11,13,15,20H,12,14H2,(H,24,29)(H,27,28) |
| InChIKey | BFLLOUQOWDRWQH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|