C20H21BrN2O5 — CID 172759704
benzyl 3-(4-bromo-2-hydroxy-5-methoxycarbonylanilino)pyrrolidine-1-carboxylate (PubChem CID 172759704) has the molecular formula C20H21BrN2O5 and a molecular weight of 449.30 g/mol. Its IUPAC name is benzyl 3-(4-bromo-2-hydroxy-5-methoxycarbonylanilino)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-(4-bromo-2-hydroxy-5-methoxycarbonylanilino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 172759704 |
| Molecular Formula | C20H21BrN2O5 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | benzyl 3-(4-bromo-2-hydroxy-5-methoxycarbonylanilino)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)c1cc(NC2CCN(C(=O)OCc3ccccc3)C2)c(O)cc1Br |
| InChI | InChI=1S/C20H21BrN2O5/c1-27-19(25)15-9-17(18(24)10-16(15)21)22-14-7-8-23(11-14)20(26)28-12-13-5-3-2-4-6-13/h2-6,9-10,14,22,24H,7-8,11-12H2,1H3 |
| InChIKey | LMZXZWXSRWLMKY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|