C21H21BrN2O7 — CID 146268506
benzyl 4-(2-bromo-5-methoxycarbonyl-4-nitrophenoxy)piperidine-1-carboxylate (PubChem CID 146268506) has the molecular formula C21H21BrN2O7 and a molecular weight of 493.31 g/mol. Its IUPAC name is benzyl 4-(2-bromo-5-methoxycarbonyl-4-nitrophenoxy)piperidine-1-carboxylate.
| Compound Name | benzyl 4-(2-bromo-5-methoxycarbonyl-4-nitrophenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146268506 |
| Molecular Formula | C21H21BrN2O7 |
| Molecular Weight | 493.31 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | benzyl 4-(2-bromo-5-methoxycarbonyl-4-nitrophenoxy)piperidine-1-carboxylate |
| SMILES | COC(=O)c1cc(OC2CCN(C(=O)OCc3ccccc3)CC2)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21BrN2O7/c1-29-20(25)16-11-19(17(22)12-18(16)24(27)28)31-15-7-9-23(10-8-15)21(26)30-13-14-5-3-2-4-6-14/h2-6,11-12,15H,7-10,13H2,1H3 |
| InChIKey | HHAZSRNMFCXHBP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|