C30H27N2O7S- — CID 68690350
naphthalen-1-yl-[2-nitro-5-(1-phenylmethoxycarbonylpiperidin-4-yl)oxyphenyl]methanesulfinate (PubChem CID 68690350) has the molecular formula C30H27N2O7S- and a molecular weight of 559.62 g/mol. Its IUPAC name is naphthalen-1-yl-[2-nitro-5-(1-phenylmethoxycarbonylpiperidin-4-yl)oxyphenyl]methanesulfinate.
| Compound Name | naphthalen-1-yl-[2-nitro-5-(1-phenylmethoxycarbonylpiperidin-4-yl)oxyphenyl]methanesulfinate |
|---|---|
| PubChem CID | 68690350 |
| Molecular Formula | C30H27N2O7S- |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | naphthalen-1-yl-[2-nitro-5-(1-phenylmethoxycarbonylpiperidin-4-yl)oxyphenyl]methanesulfinate |
| SMILES | O=C(OCc1ccccc1)N1CCC(Oc2ccc([N+](=O)[O-])c(C(c3cccc4ccccc34)S(=O)[O-])c2)CC1 |
| InChI | InChI=1S/C30H28N2O7S/c33-30(38-20-21-7-2-1-3-8-21)31-17-15-23(16-18-31)39-24-13-14-28(32(34)35)27(19-24)29(40(36)37)26-12-6-10-22-9-4-5-11-25(22)26/h1-14,19,23,29H,15-18,20H2,(H,36,37)/p-1 |
| InChIKey | MFLXCTMVMGSZHF-UHFFFAOYSA-M |
| XLogP | 5.90 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|