C29H28N2O5S — CID 68687413
[2-amino-5-(1-phenylmethoxycarbonylpyrrolidin-3-yl)oxyphenyl]-naphthalen-1-ylmethanesulfinic acid (PubChem CID 68687413) has the molecular formula C29H28N2O5S and a molecular weight of 516.62 g/mol. Its IUPAC name is [2-amino-5-(1-phenylmethoxycarbonylpyrrolidin-3-yl)oxyphenyl]-naphthalen-1-ylmethanesulfinic acid.
| Compound Name | [2-amino-5-(1-phenylmethoxycarbonylpyrrolidin-3-yl)oxyphenyl]-naphthalen-1-ylmethanesulfinic acid |
|---|---|
| PubChem CID | 68687413 |
| Molecular Formula | C29H28N2O5S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | [2-amino-5-(1-phenylmethoxycarbonylpyrrolidin-3-yl)oxyphenyl]-naphthalen-1-ylmethanesulfinic acid |
| SMILES | Nc1ccc(OC2CCN(C(=O)OCc3ccccc3)C2)cc1C(c1cccc2ccccc12)S(=O)O |
| InChI | InChI=1S/C29H28N2O5S/c30-27-14-13-22(36-23-15-16-31(18-23)29(32)35-19-20-7-2-1-3-8-20)17-26(27)28(37(33)34)25-12-6-10-21-9-4-5-11-24(21)25/h1-14,17,23,28H,15-16,18-19,30H2,(H,33,34) |
| InChIKey | IMHVGYUXABOVQD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|