C19H20ClNO4 — CID 70544615
benzyl (3R,4R)-4-(3-chlorophenoxy)-3-hydroxypiperidine-1-carboxylate (PubChem CID 70544615) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is benzyl (3R,4R)-4-(3-chlorophenoxy)-3-hydroxypiperidine-1-carboxylate.
| Compound Name | benzyl (3R,4R)-4-(3-chlorophenoxy)-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 70544615 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | benzyl (3R,4R)-4-(3-chlorophenoxy)-3-hydroxypiperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@@H](Oc2cccc(Cl)c2)[C@H](O)C1 |
| InChI | InChI=1S/C19H20ClNO4/c20-15-7-4-8-16(11-15)25-18-9-10-21(12-17(18)22)19(23)24-13-14-5-2-1-3-6-14/h1-8,11,17-18,22H,9-10,12-13H2/t17-,18-/m1/s1 |
| InChIKey | JPHFFRMRXKBSDV-QZTJIDSGSA-N |
| XLogP | 3.49 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |