C19H19Cl2NO4 — CID 54247716
benzyl (3S,4S)-4-(3,4-dichlorophenoxy)-3-hydroxypiperidine-1-carboxylate (PubChem CID 54247716) has the molecular formula C19H19Cl2NO4 and a molecular weight of 396.27 g/mol. Its IUPAC name is benzyl (3S,4S)-4-(3,4-dichlorophenoxy)-3-hydroxypiperidine-1-carboxylate.
| Compound Name | benzyl (3S,4S)-4-(3,4-dichlorophenoxy)-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 54247716 |
| Molecular Formula | C19H19Cl2NO4 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | benzyl (3S,4S)-4-(3,4-dichlorophenoxy)-3-hydroxypiperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@H](Oc2ccc(Cl)c(Cl)c2)[C@@H](O)C1 |
| InChI | InChI=1S/C19H19Cl2NO4/c20-15-7-6-14(10-16(15)21)26-18-8-9-22(11-17(18)23)19(24)25-12-13-4-2-1-3-5-13/h1-7,10,17-18,23H,8-9,11-12H2/t17-,18-/m0/s1 |
| InChIKey | QUMBHLNRDQHDKV-ROUUACIJSA-N |
| XLogP | 4.14 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |