C11H20N2O3 — CID 172765436
4-[dimethyl-[2-(prop-2-enoylamino)ethyl]azaniumyl]butanoate (PubChem CID 172765436) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-[dimethyl-[2-(prop-2-enoylamino)ethyl]azaniumyl]butanoate.
| Compound Name | 4-[dimethyl-[2-(prop-2-enoylamino)ethyl]azaniumyl]butanoate |
|---|---|
| PubChem CID | 172765436 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 4-[dimethyl-[2-(prop-2-enoylamino)ethyl]azaniumyl]butanoate |
| SMILES | C=CC(=O)NCC[N+](C)(C)CCCC(=O)[O-] |
| InChI | InChI=1S/C11H20N2O3/c1-4-10(14)12-7-9-13(2,3)8-5-6-11(15)16/h4H,1,5-9H2,2-3H3,(H-,12,14,15,16) |
| InChIKey | MGBPGLWHTLOTFE-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|