C12H22ClN3O2 — CID 70256315
N-methyl-4-(4-prop-2-enoylpiperazin-4-ium-1-yl)butanamide chloride (PubChem CID 70256315) has the molecular formula C12H22ClN3O2 and a molecular weight of 275.78 g/mol. Its IUPAC name is N-methyl-4-(4-prop-2-enoylpiperazin-4-ium-1-yl)butanamide chloride.
| Compound Name | N-methyl-4-(4-prop-2-enoylpiperazin-4-ium-1-yl)butanamide chloride |
|---|---|
| PubChem CID | 70256315 |
| Molecular Formula | C12H22ClN3O2 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-methyl-4-(4-prop-2-enoylpiperazin-4-ium-1-yl)butanamide chloride |
| SMILES | C=CC(=O)[NH+]1CCN(CCCC(=O)NC)CC1.[Cl-] |
| InChI | InChI=1S/C12H21N3O2.ClH/c1-3-12(17)15-9-7-14(8-10-15)6-4-5-11(16)13-2;/h3H,1,4-10H2,2H3,(H,13,16);1H |
| InChIKey | HCOGZPKUQXZTEP-UHFFFAOYSA-N |
| XLogP | -4.57 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | -4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|