C13H24N3O2+ — CID 18793268
4-(1-ethyl-4-prop-2-enoylpiperazin-1-ium-1-yl)butanamide (PubChem CID 18793268) has the molecular formula C13H24N3O2+ and a molecular weight of 254.35 g/mol. Its IUPAC name is 4-(1-ethyl-4-prop-2-enoylpiperazin-1-ium-1-yl)butanamide.
| Compound Name | 4-(1-ethyl-4-prop-2-enoylpiperazin-1-ium-1-yl)butanamide |
|---|---|
| PubChem CID | 18793268 |
| Molecular Formula | C13H24N3O2+ |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 4-(1-ethyl-4-prop-2-enoylpiperazin-1-ium-1-yl)butanamide |
| SMILES | C=CC(=O)N1CC[N+](CC)(CCCC(N)=O)CC1 |
| InChI | InChI=1S/C13H23N3O2/c1-3-13(18)15-7-10-16(4-2,11-8-15)9-5-6-12(14)17/h3H,1,4-11H2,2H3,(H-,14,17)/p+1 |
| InChIKey | HBDYSJJYLDMFEE-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|