C11H20ClN3O2 — CID 18793287
3-(1-methyl-4-prop-2-enoylpiperazin-1-ium-1-yl)propanamide chloride (PubChem CID 18793287) has the molecular formula C11H20ClN3O2 and a molecular weight of 261.75 g/mol. Its IUPAC name is 3-(1-methyl-4-prop-2-enoylpiperazin-1-ium-1-yl)propanamide chloride.
| Compound Name | 3-(1-methyl-4-prop-2-enoylpiperazin-1-ium-1-yl)propanamide chloride |
|---|---|
| PubChem CID | 18793287 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-(1-methyl-4-prop-2-enoylpiperazin-1-ium-1-yl)propanamide chloride |
| SMILES | C=CC(=O)N1CC[N+](C)(CCC(N)=O)CC1.[Cl-] |
| InChI | InChI=1S/C11H19N3O2.ClH/c1-3-11(16)13-5-8-14(2,9-6-13)7-4-10(12)15;/h3H,1,4-9H2,2H3,(H-,12,15);1H |
| InChIKey | UQCFKJXYLGOQIP-UHFFFAOYSA-N |
| XLogP | -3.66 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|