C12H22N3O2+ — CID 18793248
3-(1-ethyl-4-prop-2-enoylpiperazin-1-ium-1-yl)propanamide (PubChem CID 18793248) has the molecular formula C12H22N3O2+ and a molecular weight of 240.33 g/mol. Its IUPAC name is 3-(1-ethyl-4-prop-2-enoylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | 3-(1-ethyl-4-prop-2-enoylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 18793248 |
| Molecular Formula | C12H22N3O2+ |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 3-(1-ethyl-4-prop-2-enoylpiperazin-1-ium-1-yl)propanamide |
| SMILES | C=CC(=O)N1CC[N+](CC)(CCC(N)=O)CC1 |
| InChI | InChI=1S/C12H21N3O2/c1-3-12(17)14-6-9-15(4-2,10-7-14)8-5-11(13)16/h3H,1,4-10H2,2H3,(H-,13,16)/p+1 |
| InChIKey | WNRREVJRACNJRZ-UHFFFAOYSA-O |
| XLogP | -0.27 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|