C16H30O3Si3 — CID 172765668
2-bicyclo[2.2.1]hept-5-enyl-methoxy-bis(2-methylprop-1-enylsilyloxy)silane (PubChem CID 172765668) has the molecular formula C16H30O3Si3 and a molecular weight of 354.67 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enyl-methoxy-bis(2-methylprop-1-enylsilyloxy)silane.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enyl-methoxy-bis(2-methylprop-1-enylsilyloxy)silane |
|---|---|
| PubChem CID | 172765668 |
| Molecular Formula | C16H30O3Si3 |
| Molecular Weight | 354.67 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enyl-methoxy-bis(2-methylprop-1-enylsilyloxy)silane |
| SMILES | CO[Si](O[SiH2]C=C(C)C)(O[SiH2]C=C(C)C)C1CC2C=CC1C2 |
| InChI | InChI=1S/C16H30O3Si3/c1-12(2)10-20-18-22(17-5,19-21-11-13(3)4)16-9-14-6-7-15(16)8-14/h6-7,10-11,14-16H,8-9,20-21H2,1-5H3 |
| InChIKey | MGVSKZQENDFOCR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.67 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|