C46H40N2O6 — CID 172766947
benzyl (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxy-4-oxo-4-(tritylamino)butanoate (PubChem CID 172766947) has the molecular formula C46H40N2O6 and a molecular weight of 716.83 g/mol. Its IUPAC name is benzyl (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxy-4-oxo-4-(tritylamino)butanoate.
| Compound Name | benzyl (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxy-4-oxo-4-(tritylamino)butanoate |
|---|---|
| PubChem CID | 172766947 |
| Molecular Formula | C46H40N2O6 |
| Molecular Weight | 716.83 g/mol |
| Exact Mass | 716.29 |
| IUPAC Name | benzyl (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxy-4-oxo-4-(tritylamino)butanoate |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)[C@H](C(=O)OCc1ccccc1)[C@@H](O)C(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H40N2O6/c1-48(45(52)54-31-40-38-28-16-14-26-36(38)37-27-15-17-29-39(37)40)41(44(51)53-30-32-18-6-2-7-19-32)42(49)43(50)47-46(33-20-8-3-9-21-33,34-22-10-4-11-23-34)35-24-12-5-13-25-35/h2-29,40-42,49H,30-31H2,1H3,(H,47,50)/t41-,42+/m0/s1 |
| InChIKey | MLAQWKGKMWNZAN-ACEXITHZSA-N |
| XLogP | 7.45 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.83 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|