C25H21ClN3O3S+ — CID 172781597
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-[3-(2-cyclopropylethynyl)-5-methoxyphenyl]-2-hydroxy-9-methylpyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 172781597) has the molecular formula C25H21ClN3O3S+ and a molecular weight of 478.98 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-[3-(2-cyclopropylethynyl)-5-methoxyphenyl]-2-hydroxy-9-methylpyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-[3-(2-cyclopropylethynyl)-5-methoxyphenyl]-2-hydroxy-9-methylpyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 172781597 |
| Molecular Formula | C25H21ClN3O3S+ |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-[3-(2-cyclopropylethynyl)-5-methoxyphenyl]-2-hydroxy-9-methylpyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | COc1cc(C#CC2CC2)cc(-c2c(O)[n+](Cc3cnc(Cl)s3)c3c(C)cccn3c2=O)c1 |
| InChI | InChI=1S/C25H20ClN3O3S/c1-15-4-3-9-28-22(15)29(14-20-13-27-25(26)33-20)24(31)21(23(28)30)18-10-17(8-7-16-5-6-16)11-19(12-18)32-2/h3-4,9-13,16H,5-6,14H2,1-2H3/p+1 |
| InChIKey | OIIAQIWMXIQJTG-UHFFFAOYSA-O |
| XLogP | 4.20 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|