C14H16Cl2N2 — CID 172782287
2,2-diphenylethanimidamide;dihydrochloride (PubChem CID 172782287) has the molecular formula C14H16Cl2N2 and a molecular weight of 283.20 g/mol. Its IUPAC name is 2,2-diphenylethanimidamide;dihydrochloride.
| Compound Name | 2,2-diphenylethanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 172782287 |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2,2-diphenylethanimidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14N2.2ClH/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-10,13H,(H3,15,16);2*1H |
| InChIKey | OKODQTJIILPSPP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|