C12H10Br2N4 — CID 175691513
2-(3,5-dibromopyrazin-2-yl)-2-phenylethanimidamide (PubChem CID 175691513) has the molecular formula C12H10Br2N4 and a molecular weight of 370.05 g/mol. Its IUPAC name is 2-(3,5-dibromopyrazin-2-yl)-2-phenylethanimidamide.
| Compound Name | 2-(3,5-dibromopyrazin-2-yl)-2-phenylethanimidamide |
|---|---|
| PubChem CID | 175691513 |
| Molecular Formula | C12H10Br2N4 |
| Molecular Weight | 370.05 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | 2-(3,5-dibromopyrazin-2-yl)-2-phenylethanimidamide |
| SMILES | [H]/N=C(\N)C(c1ccccc1)c1ncc(Br)nc1Br |
| InChI | InChI=1S/C12H10Br2N4/c13-8-6-17-10(11(14)18-8)9(12(15)16)7-4-2-1-3-5-7/h1-6,9H,(H3,15,16) |
| InChIKey | ZRXPDBCKXYQNPZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.05 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|