About N,N-diethyl-2,2-diphenylethanimidamide
N,N-diethyl-2,2-diphenylethanimidamide (PubChem CID 63179563) has the molecular formula C18H22N2
and a molecular weight of 266.39 g/mol. Its IUPAC name is N,N-diethyl-2,2-diphenylethanimidamide.
Molecular Properties
| Compound Name | N,N-diethyl-2,2-diphenylethanimidamide |
| PubChem CID | 63179563 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N,N-diethyl-2,2-diphenylethanimidamide |
| SMILES | [H]/N=C(/C(c1ccccc1)c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C18H22N2/c1-3-20(4-2)18(19)17(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17,19H,3-4H2,1-2H3/b19-18- |
| InChIKey | DAROIYCNJVJJIV-HNENSFHCSA-N |
| XLogP | 4.14 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-2,2-diphenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2,2-diphenylethanimidamide?
The IUPAC name of N,N-diethyl-2,2-diphenylethanimidamide (CID 63179563) is N,N-diethyl-2,2-diphenylethanimidamide.
What is the SMILES notation for N,N-diethyl-2,2-diphenylethanimidamide?
The canonical SMILES for N,N-diethyl-2,2-diphenylethanimidamide is [H]/N=C(/C(c1ccccc1)c1ccccc1)N(CC)CC.
What is the InChIKey of N,N-diethyl-2,2-diphenylethanimidamide?
The InChIKey is DAROIYCNJVJJIV-HNENSFHCSA-N. The full InChI is InChI=1S/C18H22N2/c1-3-20(4-2)18(19)17(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17,19H,3-4H2,1-2H3/b19-18-.
What are the key properties of N,N-diethyl-2,2-diphenylethanimidamide?
N,N-diethyl-2,2-diphenylethanimidamide has a molecular weight of 266.39 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2,2-diphenylethanimidamide is sourced from PubChem (CID 63179563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).