C26H20F2N4O4 — CID 172784130
(1R,11R)-17-(difluoromethoxy)-18-[6-(2-hydroxypropanoyl)-2-pyridinyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3,5,7,9,14(19),15,17-heptaen-13-one (PubChem CID 172784130) has the molecular formula C26H20F2N4O4 and a molecular weight of 490.47 g/mol. Its IUPAC name is (1R,11R)-17-(difluoromethoxy)-18-[6-(2-hydroxypropanoyl)-2-pyridinyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3,5,7,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11R)-17-(difluoromethoxy)-18-[6-(2-hydroxypropanoyl)-2-pyridinyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3,5,7,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 172784130 |
| Molecular Formula | C26H20F2N4O4 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (1R,11R)-17-(difluoromethoxy)-18-[6-(2-hydroxypropanoyl)-2-pyridinyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3,5,7,9,14(19),15,17-heptaen-13-one |
| SMILES | CC(O)C(=O)c1cccc(-c2c(OC(F)F)ccc3c2[C@H]2C[C@@H](NC3=O)c3nc4ccccc4n32)n1 |
| InChI | InChI=1S/C26H20F2N4O4/c1-12(33)23(34)16-7-4-6-15(29-16)22-20(36-26(27)28)10-9-13-21(22)19-11-17(31-25(13)35)24-30-14-5-2-3-8-18(14)32(19)24/h2-10,12,17,19,26,33H,11H2,1H3,(H,31,35)/t12?,17-,19-/m1/s1 |
| InChIKey | OQPMEKPSHYOQAL-RHABNTCASA-N |
| XLogP | 4.04 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |