C27H23F3N3O3P — CID 171643536
(1R,11S)-18-(difluoromethoxy)-5-[4-(dimethylphosphorylmethyl)-3-fluorophenyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 171643536) has the molecular formula C27H23F3N3O3P and a molecular weight of 525.47 g/mol. Its IUPAC name is (1R,11S)-18-(difluoromethoxy)-5-[4-(dimethylphosphorylmethyl)-3-fluorophenyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11S)-18-(difluoromethoxy)-5-[4-(dimethylphosphorylmethyl)-3-fluorophenyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 171643536 |
| Molecular Formula | C27H23F3N3O3P |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | (1R,11S)-18-(difluoromethoxy)-5-[4-(dimethylphosphorylmethyl)-3-fluorophenyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | CP(C)(=O)Cc1ccc(-c2ccc3nc4n(c3c2)[C@@H]2C[C@@H]4NC(=O)c3cccc(OC(F)F)c32)cc1F |
| InChI | InChI=1S/C27H23F3N3O3P/c1-37(2,35)13-16-7-6-14(10-18(16)28)15-8-9-19-21(11-15)33-22-12-20(25(33)31-19)32-26(34)17-4-3-5-23(24(17)22)36-27(29)30/h3-11,20,22,27H,12-13H2,1-2H3,(H,32,34)/t20-,22+/m0/s1 |
| InChIKey | HZQWKZUKZFEKSJ-RBBKRZOGSA-N |
| XLogP | 6.34 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|