C28H25F3N3O3P — CID 171643539
(1R,11R)-18-(difluoromethoxy)-5-[4-(dimethylphosphorylmethyl)-3-fluorophenyl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 171643539) has the molecular formula C28H25F3N3O3P and a molecular weight of 539.49 g/mol. Its IUPAC name is (1R,11R)-18-(difluoromethoxy)-5-[4-(dimethylphosphorylmethyl)-3-fluorophenyl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11R)-18-(difluoromethoxy)-5-[4-(dimethylphosphorylmethyl)-3-fluorophenyl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 171643539 |
| Molecular Formula | C28H25F3N3O3P |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | (1R,11R)-18-(difluoromethoxy)-5-[4-(dimethylphosphorylmethyl)-3-fluorophenyl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | CN1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nc3ccc(-c4ccc(CP(C)(C)=O)c(F)c4)cc3n12 |
| InChI | InChI=1S/C28H25F3N3O3P/c1-33-23-13-22(25-18(27(33)35)5-4-6-24(25)37-28(30)31)34-21-12-16(9-10-20(21)32-26(23)34)15-7-8-17(19(29)11-15)14-38(2,3)36/h4-12,22-23,28H,13-14H2,1-3H3/t22-,23-/m1/s1 |
| InChIKey | JZWHGIMMDUHBCW-DHIUTWEWSA-N |
| XLogP | 6.69 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|