C27H24F2N6O3 — CID 178130185
(1R,11R)-18-(difluoromethoxy)-5-[2-[1-(hydroxyamino)cyclobutyl]pyrimidin-5-yl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 178130185) has the molecular formula C27H24F2N6O3 and a molecular weight of 518.52 g/mol. Its IUPAC name is (1R,11R)-18-(difluoromethoxy)-5-[2-[1-(hydroxyamino)cyclobutyl]pyrimidin-5-yl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11R)-18-(difluoromethoxy)-5-[2-[1-(hydroxyamino)cyclobutyl]pyrimidin-5-yl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 178130185 |
| Molecular Formula | C27H24F2N6O3 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | (1R,11R)-18-(difluoromethoxy)-5-[2-[1-(hydroxyamino)cyclobutyl]pyrimidin-5-yl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | CN1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nc3ccc(-c4cnc(C5(NO)CCC5)nc4)cc3n12 |
| InChI | InChI=1S/C27H24F2N6O3/c1-34-20-11-19(22-16(24(34)36)4-2-5-21(22)38-26(28)29)35-18-10-14(6-7-17(18)32-23(20)35)15-12-30-25(31-13-15)27(33-37)8-3-9-27/h2,4-7,10,12-13,19-20,26,33,37H,3,8-9,11H2,1H3/t19-,20-/m1/s1 |
| InChIKey | XIFJGCFUVFJQGV-WOJBJXKFSA-N |
| XLogP | 4.57 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|