C26H23F4N3O2 — CID 171806183
(1R)-5-[2-(2,2-difluorocyclopropyl)ethynyl]-18-(difluoromethoxy)-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one;ethane (PubChem CID 171806183) has the molecular formula C26H23F4N3O2 and a molecular weight of 485.48 g/mol. Its IUPAC name is (1R)-5-[2-(2,2-difluorocyclopropyl)ethynyl]-18-(difluoromethoxy)-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one;ethane.
| Compound Name | (1R)-5-[2-(2,2-difluorocyclopropyl)ethynyl]-18-(difluoromethoxy)-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one;ethane |
|---|---|
| PubChem CID | 171806183 |
| Molecular Formula | C26H23F4N3O2 |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | (1R)-5-[2-(2,2-difluorocyclopropyl)ethynyl]-18-(difluoromethoxy)-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one;ethane |
| SMILES | CC.CN1C(=O)c2cccc(OC(F)F)c2[C@H]2CC1c1nc3ccc(C#CC4CC4(F)F)cc3n12 |
| InChI | InChI=1S/C24H17F4N3O2.C2H6/c1-30-18-10-17(20-14(22(30)32)3-2-4-19(20)33-23(25)26)31-16-9-12(5-7-13-11-24(13,27)28)6-8-15(16)29-21(18)31;1-2/h2-4,6,8-9,13,17-18,23H,10-11H2,1H3;1-2H3/t13?,17-,18?;/m1./s1 |
| InChIKey | KMTMKSWBBSTYQB-QOECITOCSA-N |
| XLogP | 5.79 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|