C28H28F2N4O3 — CID 174341305
(1R)-18-(difluoromethoxy)-12-methyl-5-[3-(1-methylpiperidin-4-yl)oxyprop-1-ynyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 174341305) has the molecular formula C28H28F2N4O3 and a molecular weight of 506.55 g/mol. Its IUPAC name is (1R)-18-(difluoromethoxy)-12-methyl-5-[3-(1-methylpiperidin-4-yl)oxyprop-1-ynyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R)-18-(difluoromethoxy)-12-methyl-5-[3-(1-methylpiperidin-4-yl)oxyprop-1-ynyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 174341305 |
| Molecular Formula | C28H28F2N4O3 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (1R)-18-(difluoromethoxy)-12-methyl-5-[3-(1-methylpiperidin-4-yl)oxyprop-1-ynyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | CN1CCC(OCC#Cc2ccc3nc4n(c3c2)[C@@H]2CC4N(C)C(=O)c3cccc(OC(F)F)c32)CC1 |
| InChI | InChI=1S/C28H28F2N4O3/c1-32-12-10-18(11-13-32)36-14-4-5-17-8-9-20-21(15-17)34-22-16-23(26(34)31-20)33(2)27(35)19-6-3-7-24(25(19)22)37-28(29)30/h3,6-9,15,18,22-23,28H,10-14,16H2,1-2H3/t22-,23?/m1/s1 |
| InChIKey | LPFCOMJUGXEBTF-WTQRLHSKSA-N |
| XLogP | 4.22 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|