C25H23F2N3O3 — CID 171805890
(1R,11R)-18-(difluoromethoxy)-5-(5-hydroxyhex-1-ynyl)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 171805890) has the molecular formula C25H23F2N3O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is (1R,11R)-18-(difluoromethoxy)-5-(5-hydroxyhex-1-ynyl)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11R)-18-(difluoromethoxy)-5-(5-hydroxyhex-1-ynyl)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 171805890 |
| Molecular Formula | C25H23F2N3O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (1R,11R)-18-(difluoromethoxy)-5-(5-hydroxyhex-1-ynyl)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | [2H]C([2H])([2H])N1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nc3ccc(C#CCCC(C)O)cc3n12 |
| InChI | InChI=1S/C25H23F2N3O3/c1-14(31)6-3-4-7-15-10-11-17-18(12-15)30-19-13-20(23(30)28-17)29(2)24(32)16-8-5-9-21(22(16)19)33-25(26)27/h5,8-12,14,19-20,25,31H,3,6,13H2,1-2H3/t14?,19-,20-/m1/s1/i2D3 |
| InChIKey | KYZAACMAFNIRMX-RVUSRAEJSA-N |
| XLogP | 4.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|