C26H26F2N4O3 — CID 171805863
(1R,11R)-5-(3-amino-5-hydroxy-5-methylhex-1-ynyl)-18-(difluoromethoxy)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 171805863) has the molecular formula C26H26F2N4O3 and a molecular weight of 483.53 g/mol. Its IUPAC name is (1R,11R)-5-(3-amino-5-hydroxy-5-methylhex-1-ynyl)-18-(difluoromethoxy)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11R)-5-(3-amino-5-hydroxy-5-methylhex-1-ynyl)-18-(difluoromethoxy)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 171805863 |
| Molecular Formula | C26H26F2N4O3 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (1R,11R)-5-(3-amino-5-hydroxy-5-methylhex-1-ynyl)-18-(difluoromethoxy)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | [2H]C([2H])([2H])N1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nc3ccc(C#CC(N)CC(C)(C)O)cc3n12 |
| InChI | InChI=1S/C26H26F2N4O3/c1-26(2,34)13-15(29)9-7-14-8-10-17-18(11-14)32-19-12-20(23(32)30-17)31(3)24(33)16-5-4-6-21(22(16)19)35-25(27)28/h4-6,8,10-11,15,19-20,25,34H,12-13,29H2,1-3H3/t15?,19-,20-/m1/s1/i3D3 |
| InChIKey | HKTOLINEWUWMBC-WDPMRFTLSA-N |
| XLogP | 3.60 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|