C26H24F2N4O2 — CID 171805766
(1R,11R)-18-(difluoromethoxy)-5-(2-piperidin-3-ylethynyl)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 171805766) has the molecular formula C26H24F2N4O2 and a molecular weight of 465.52 g/mol. Its IUPAC name is (1R,11R)-18-(difluoromethoxy)-5-(2-piperidin-3-ylethynyl)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11R)-18-(difluoromethoxy)-5-(2-piperidin-3-ylethynyl)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 171805766 |
| Molecular Formula | C26H24F2N4O2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (1R,11R)-18-(difluoromethoxy)-5-(2-piperidin-3-ylethynyl)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | [2H]C([2H])([2H])N1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nc3ccc(C#CC4CCCNC4)cc3n12 |
| InChI | InChI=1S/C26H24F2N4O2/c1-31-21-13-20(23-17(25(31)33)5-2-6-22(23)34-26(27)28)32-19-12-15(9-10-18(19)30-24(21)32)7-8-16-4-3-11-29-14-16/h2,5-6,9-10,12,16,20-21,26,29H,3-4,11,13-14H2,1H3/t16?,20-,21-/m1/s1/i1D3 |
| InChIKey | GWIIJBCEUPNGCI-HWUQSLAOSA-N |
| XLogP | 4.11 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|