C26H20F2N4O2 — CID 171805764
3-[2-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]ethynyl]cyclobutane-1-carbonitrile (PubChem CID 171805764) has the molecular formula C26H20F2N4O2 and a molecular weight of 461.49 g/mol. Its IUPAC name is 3-[2-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]ethynyl]cyclobutane-1-carbonitrile.
| Compound Name | 3-[2-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]ethynyl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 171805764 |
| Molecular Formula | C26H20F2N4O2 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 3-[2-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]ethynyl]cyclobutane-1-carbonitrile |
| SMILES | [2H]C([2H])([2H])N1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nc3ccc(C#CC4CC(C#N)C4)cc3n12 |
| InChI | InChI=1S/C26H20F2N4O2/c1-31-21-12-20(23-17(25(31)33)3-2-4-22(23)34-26(27)28)32-19-11-14(7-8-18(19)30-24(21)32)5-6-15-9-16(10-15)13-29/h2-4,7-8,11,15-16,20-21,26H,9-10,12H2,1H3/t15?,16?,20-,21-/m1/s1/i1D3 |
| InChIKey | DOWGVCLCPYGEMD-XWYQJLTNSA-N |
| XLogP | 4.66 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|