C22H15F2N3O3 — CID 171805879
3-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]prop-2-ynal (PubChem CID 171805879) has the molecular formula C22H15F2N3O3 and a molecular weight of 410.39 g/mol. Its IUPAC name is 3-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]prop-2-ynal.
| Compound Name | 3-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]prop-2-ynal |
|---|---|
| PubChem CID | 171805879 |
| Molecular Formula | C22H15F2N3O3 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 3-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]prop-2-ynal |
| SMILES | [2H]C([2H])([2H])N1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nc3ccc(C#CC=O)cc3n12 |
| InChI | InChI=1S/C22H15F2N3O3/c1-26-17-11-16(19-13(21(26)29)5-2-6-18(19)30-22(23)24)27-15-10-12(4-3-9-28)7-8-14(15)25-20(17)27/h2,5-10,16-17,22H,11H2,1H3/t16-,17-/m1/s1/i1D3 |
| InChIKey | NKJFFHPUAZPPPQ-MVOYJBSWSA-N |
| XLogP | 3.31 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|