C24H19F2N3O3 — CID 171806247
(1R,11R)-18-(difluoromethoxy)-5-[2-(oxetan-3-yl)ethynyl]-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 171806247) has the molecular formula C24H19F2N3O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is (1R,11R)-18-(difluoromethoxy)-5-[2-(oxetan-3-yl)ethynyl]-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11R)-18-(difluoromethoxy)-5-[2-(oxetan-3-yl)ethynyl]-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 171806247 |
| Molecular Formula | C24H19F2N3O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (1R,11R)-18-(difluoromethoxy)-5-[2-(oxetan-3-yl)ethynyl]-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | [2H]C([2H])([2H])N1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nc3ccc(C#CC4COC4)cc3n12 |
| InChI | InChI=1S/C24H19F2N3O3/c1-28-19-10-18(21-15(23(28)30)3-2-4-20(21)32-24(25)26)29-17-9-13(5-6-14-11-31-12-14)7-8-16(17)27-22(19)29/h2-4,7-9,14,18-19,24H,10-12H2,1H3/t18-,19-/m1/s1/i1D3 |
| InChIKey | CEYPLMNTNNKYJN-ASFMBUNISA-N |
| XLogP | 3.76 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|