C27H26F2N4O2 — CID 171806182
(1R)-18-(difluoromethoxy)-12-methyl-5-(4-pyrrolidin-1-ylbut-1-ynyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 171806182) has the molecular formula C27H26F2N4O2 and a molecular weight of 476.53 g/mol. Its IUPAC name is (1R)-18-(difluoromethoxy)-12-methyl-5-(4-pyrrolidin-1-ylbut-1-ynyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R)-18-(difluoromethoxy)-12-methyl-5-(4-pyrrolidin-1-ylbut-1-ynyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 171806182 |
| Molecular Formula | C27H26F2N4O2 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | (1R)-18-(difluoromethoxy)-12-methyl-5-(4-pyrrolidin-1-ylbut-1-ynyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | CN1C(=O)c2cccc(OC(F)F)c2[C@H]2CC1c1nc3ccc(C#CCCN4CCCC4)cc3n12 |
| InChI | InChI=1S/C27H26F2N4O2/c1-31-22-16-21(24-18(26(31)34)8-6-9-23(24)35-27(28)29)33-20-15-17(10-11-19(20)30-25(22)33)7-2-3-12-32-13-4-5-14-32/h6,8-11,15,21-22,27H,3-5,12-14,16H2,1H3/t21-,22?/m1/s1 |
| InChIKey | UVAQKWCVENRLIK-ZMFCMNQTSA-N |
| XLogP | 4.59 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|