C27H20F2N4O2 — CID 171805830
18-(difluoromethoxy)-12-methyl-5-[2-(6-methyl-3-pyridinyl)ethynyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 171805830) has the molecular formula C27H20F2N4O2 and a molecular weight of 470.48 g/mol. Its IUPAC name is 18-(difluoromethoxy)-12-methyl-5-[2-(6-methyl-3-pyridinyl)ethynyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | 18-(difluoromethoxy)-12-methyl-5-[2-(6-methyl-3-pyridinyl)ethynyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 171805830 |
| Molecular Formula | C27H20F2N4O2 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 18-(difluoromethoxy)-12-methyl-5-[2-(6-methyl-3-pyridinyl)ethynyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | Cc1ccc(C#Cc2ccc3nc4n(c3c2)C2CC4N(C)C(=O)c3cccc(OC(F)F)c32)cn1 |
| InChI | InChI=1S/C27H20F2N4O2/c1-15-6-7-17(14-30-15)9-8-16-10-11-19-20(12-16)33-21-13-22(25(33)31-19)32(2)26(34)18-4-3-5-23(24(18)21)35-27(28)29/h3-7,10-12,14,21-22,27H,13H2,1-2H3 |
| InChIKey | FIZOBQCLVYHIQT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|