C22H23F2N3O2 — CID 171806201
(1R)-18-(difluoromethoxy)-5,12-dimethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one;ethane (PubChem CID 171806201) has the molecular formula C22H23F2N3O2 and a molecular weight of 399.44 g/mol. Its IUPAC name is (1R)-18-(difluoromethoxy)-5,12-dimethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one;ethane.
| Compound Name | (1R)-18-(difluoromethoxy)-5,12-dimethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one;ethane |
|---|---|
| PubChem CID | 171806201 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (1R)-18-(difluoromethoxy)-5,12-dimethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one;ethane |
| SMILES | CC.Cc1ccc2nc3n(c2c1)[C@@H]1CC3N(C)C(=O)c2cccc(OC(F)F)c21 |
| InChI | InChI=1S/C20H17F2N3O2.C2H6/c1-10-6-7-12-13(8-10)25-14-9-15(18(25)23-12)24(2)19(26)11-4-3-5-16(17(11)14)27-20(21)22;1-2/h3-8,14-15,20H,9H2,1-2H3;1-2H3/t14-,15?;/m1./s1 |
| InChIKey | MXKNYHSRUFZFAI-FUISWZMFSA-N |
| XLogP | 5.09 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |