C28H22F3N4O2P — CID 178024869
(1S,13S)-11-(difluoromethoxy)-17-(4-dimethylphosphoryl-3-fluorophenyl)-2,5,14,21-tetrazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7(12),8,10,15(20),16,18,21-nonaene (PubChem CID 178024869) has the molecular formula C28H22F3N4O2P and a molecular weight of 534.48 g/mol. Its IUPAC name is (1S,13S)-11-(difluoromethoxy)-17-(4-dimethylphosphoryl-3-fluorophenyl)-2,5,14,21-tetrazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7(12),8,10,15(20),16,18,21-nonaene.
| Compound Name | (1S,13S)-11-(difluoromethoxy)-17-(4-dimethylphosphoryl-3-fluorophenyl)-2,5,14,21-tetrazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7(12),8,10,15(20),16,18,21-nonaene |
|---|---|
| PubChem CID | 178024869 |
| Molecular Formula | C28H22F3N4O2P |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | (1S,13S)-11-(difluoromethoxy)-17-(4-dimethylphosphoryl-3-fluorophenyl)-2,5,14,21-tetrazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7(12),8,10,15(20),16,18,21-nonaene |
| SMILES | CP(C)(=O)c1ccc(-c2ccc3nc4n(c3c2)[C@H]2C[C@@H]4n3ccnc3-c3cccc(OC(F)F)c32)cc1F |
| InChI | InChI=1S/C28H22F3N4O2P/c1-38(2,36)24-9-7-15(12-18(24)29)16-6-8-19-20(13-16)35-21-14-22(27(35)33-19)34-11-10-32-26(34)17-4-3-5-23(25(17)21)37-28(30)31/h3-13,21-22,28H,14H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | YRPWZWYUVAVTBC-VXKWHMMOSA-N |
| XLogP | 6.45 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|