C27H24ClFN3O2P — CID 177367065
(1R,11R)-18-chloro-5-(4-dimethylphosphoryl-3-fluorophenyl)-12-ethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 177367065) has the molecular formula C27H24ClFN3O2P and a molecular weight of 507.93 g/mol. Its IUPAC name is (1R,11R)-18-chloro-5-(4-dimethylphosphoryl-3-fluorophenyl)-12-ethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11R)-18-chloro-5-(4-dimethylphosphoryl-3-fluorophenyl)-12-ethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 177367065 |
| Molecular Formula | C27H24ClFN3O2P |
| Molecular Weight | 507.93 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | (1R,11R)-18-chloro-5-(4-dimethylphosphoryl-3-fluorophenyl)-12-ethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | CCN1C(=O)c2cccc(Cl)c2[C@H]2C[C@@H]1c1nc3ccc(-c4ccc(P(C)(C)=O)c(F)c4)cc3n12 |
| InChI | InChI=1S/C27H24ClFN3O2P/c1-4-31-23-14-22(25-17(27(31)33)6-5-7-18(25)28)32-21-13-16(8-10-20(21)30-26(23)32)15-9-11-24(19(29)12-15)35(2,3)34/h5-13,22-23H,4,14H2,1-3H3/t22-,23-/m1/s1 |
| InChIKey | MASRXRRUQDHSKO-DHIUTWEWSA-N |
| XLogP | 6.25 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.93 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|