C26H22BrFN3OP — CID 177367133
18-bromo-5-(4-dimethylphosphanyl-2-fluorophenyl)-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 177367133) has the molecular formula C26H22BrFN3OP and a molecular weight of 522.36 g/mol. Its IUPAC name is 18-bromo-5-(4-dimethylphosphanyl-2-fluorophenyl)-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | 18-bromo-5-(4-dimethylphosphanyl-2-fluorophenyl)-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 177367133 |
| Molecular Formula | C26H22BrFN3OP |
| Molecular Weight | 522.36 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 18-bromo-5-(4-dimethylphosphanyl-2-fluorophenyl)-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | CN1C(=O)c2cccc(Br)c2C2CC1c1nc3ccc(-c4ccc(P(C)C)cc4F)cc3n12 |
| InChI | InChI=1S/C26H22BrFN3OP/c1-30-23-13-22(24-17(26(30)32)5-4-6-18(24)27)31-21-11-14(7-10-20(21)29-25(23)31)16-9-8-15(33(2)3)12-19(16)28/h4-12,22-23H,13H2,1-3H3 |
| InChIKey | ISNCIOZEICVBQV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.36 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|