C26H24FN4OP — CID 177367103
5-(3-amino-4-dimethylphosphanylphenyl)-18-fluoro-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 177367103) has the molecular formula C26H24FN4OP and a molecular weight of 458.48 g/mol. Its IUPAC name is 5-(3-amino-4-dimethylphosphanylphenyl)-18-fluoro-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | 5-(3-amino-4-dimethylphosphanylphenyl)-18-fluoro-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 177367103 |
| Molecular Formula | C26H24FN4OP |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 5-(3-amino-4-dimethylphosphanylphenyl)-18-fluoro-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | CN1C(=O)c2cccc(F)c2C2CC1c1nc3ccc(-c4ccc(P(C)C)c(N)c4)cc3n12 |
| InChI | InChI=1S/C26H24FN4OP/c1-30-22-13-21(24-16(26(30)32)5-4-6-17(24)27)31-20-12-15(7-9-19(20)29-25(22)31)14-8-10-23(33(2)3)18(28)11-14/h4-12,21-22H,13,28H2,1-3H3 |
| InChIKey | KVKUTXYFVRXZBF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|