C26H22F2N3O2P — CID 177367131
(1R,11R)-5-(4-dimethylphosphoryl-3-fluorophenyl)-18-fluoro-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 177367131) has the molecular formula C26H22F2N3O2P and a molecular weight of 477.45 g/mol. Its IUPAC name is (1R,11R)-5-(4-dimethylphosphoryl-3-fluorophenyl)-18-fluoro-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11R)-5-(4-dimethylphosphoryl-3-fluorophenyl)-18-fluoro-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 177367131 |
| Molecular Formula | C26H22F2N3O2P |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | (1R,11R)-5-(4-dimethylphosphoryl-3-fluorophenyl)-18-fluoro-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | CN1C(=O)c2cccc(F)c2[C@H]2C[C@@H]1c1nc3ccc(-c4ccc(P(C)(C)=O)c(F)c4)cc3n12 |
| InChI | InChI=1S/C26H22F2N3O2P/c1-30-22-13-21(24-16(26(30)32)5-4-6-17(24)27)31-20-12-15(7-9-19(20)29-25(22)31)14-8-10-23(18(28)11-14)34(2,3)33/h4-12,21-22H,13H2,1-3H3/t21-,22-/m1/s1 |
| InChIKey | SZCPNFQIJJWSRO-FGZHOGPDSA-N |
| XLogP | 5.35 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|