C29H23FN5OP — CID 178024807
(1S,13S)-17-(4-dimethylphosphoryl-3-fluorophenyl)-11-prop-1-ynyl-2,3,5,14,21-pentazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7,9,11,15(20),16,18,21-nonaene (PubChem CID 178024807) has the molecular formula C29H23FN5OP and a molecular weight of 507.51 g/mol. Its IUPAC name is (1S,13S)-17-(4-dimethylphosphoryl-3-fluorophenyl)-11-prop-1-ynyl-2,3,5,14,21-pentazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7,9,11,15(20),16,18,21-nonaene.
| Compound Name | (1S,13S)-17-(4-dimethylphosphoryl-3-fluorophenyl)-11-prop-1-ynyl-2,3,5,14,21-pentazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7,9,11,15(20),16,18,21-nonaene |
|---|---|
| PubChem CID | 178024807 |
| Molecular Formula | C29H23FN5OP |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (1S,13S)-17-(4-dimethylphosphoryl-3-fluorophenyl)-11-prop-1-ynyl-2,3,5,14,21-pentazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7,9,11,15(20),16,18,21-nonaene |
| SMILES | CC#Cc1cccc2c1[C@@H]1C[C@@H](c3nc4ccc(-c5ccc(P(C)(C)=O)c(F)c5)cc4n31)n1ncnc1-2 |
| InChI | InChI=1S/C29H23FN5OP/c1-4-6-17-7-5-8-20-27(17)24-15-25(35-28(20)31-16-32-35)29-33-22-11-9-19(14-23(22)34(24)29)18-10-12-26(21(30)13-18)37(2,3)36/h5,7-14,16,24-25H,15H2,1-3H3/t24-,25-/m0/s1 |
| InChIKey | WJDNDNYOCBGLCE-DQEYMECFSA-N |
| XLogP | 5.62 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|