C27H23F2N6O2P — CID 178024885
(1S,13S)-11-(difluoromethoxy)-17-(6-dimethylphosphoryl-3-pyridinyl)-4-methyl-2,3,5,14,21-pentazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7(12),8,10,15(20),16,18,21-nonaene (PubChem CID 178024885) has the molecular formula C27H23F2N6O2P and a molecular weight of 532.49 g/mol. Its IUPAC name is (1S,13S)-11-(difluoromethoxy)-17-(6-dimethylphosphoryl-3-pyridinyl)-4-methyl-2,3,5,14,21-pentazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7(12),8,10,15(20),16,18,21-nonaene.
| Compound Name | (1S,13S)-11-(difluoromethoxy)-17-(6-dimethylphosphoryl-3-pyridinyl)-4-methyl-2,3,5,14,21-pentazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7(12),8,10,15(20),16,18,21-nonaene |
|---|---|
| PubChem CID | 178024885 |
| Molecular Formula | C27H23F2N6O2P |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | (1S,13S)-11-(difluoromethoxy)-17-(6-dimethylphosphoryl-3-pyridinyl)-4-methyl-2,3,5,14,21-pentazahexacyclo[11.9.1.02,6.07,12.014,22.015,20]tricosa-3,5,7(12),8,10,15(20),16,18,21-nonaene |
| SMILES | Cc1nc2n(n1)[C@H]1C[C@@H](c3c(OC(F)F)cccc3-2)n2c1nc1ccc(-c3ccc(P(C)(C)=O)nc3)cc12 |
| InChI | InChI=1S/C27H23F2N6O2P/c1-14-31-25-17-5-4-6-22(37-27(28)29)24(17)20-12-21(35(25)33-14)26-32-18-9-7-15(11-19(18)34(20)26)16-8-10-23(30-13-16)38(2,3)36/h4-11,13,20-21,27H,12H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | OJEJLDZYEXRZNY-SFTDATJTSA-N |
| XLogP | 5.41 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|