About CID 171643848
CID 171643848 (PubChem CID 171643848) has the molecular formula C27H21B3F2N3O2P
and a molecular weight of 520.89 g/mol.
Molecular Properties
| Compound Name | CID 171643848 |
| PubChem CID | 171643848 |
| Molecular Formula | C27H21B3F2N3O2P |
| Molecular Weight | 520.89 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N1C(=O)c2cccc(OC(F)F)c2C2CC1c1nc3ccc(-c4ccc(P(C)C)cc4)cc3n12 |
| InChI | InChI=1S/C27H21B3F2N3O2P/c1-38(2)16-9-6-14(7-10-16)15-8-11-18-19(12-15)34-20-13-21(24(34)33-18)35(27(28,29)30)25(36)17-4-3-5-22(23(17)20)37-26(31)32/h3-12,20-21,26H,13H2,1-2H3 |
| InChIKey | WBEJEKMRKBUADK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.89 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 171643848 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171643848?
The IUPAC name of CID 171643848 (CID 171643848) is not available.
What is the SMILES notation for CID 171643848?
The canonical SMILES for CID 171643848 is [B]C([B])([B])N1C(=O)c2cccc(OC(F)F)c2C2CC1c1nc3ccc(-c4ccc(P(C)C)cc4)cc3n12.
What is the InChIKey of CID 171643848?
The InChIKey is WBEJEKMRKBUADK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21B3F2N3O2P/c1-38(2)16-9-6-14(7-10-16)15-8-11-18-19(12-15)34-20-13-21(24(34)33-18)35(27(28,29)30)25(36)17-4-3-5-22(23(17)20)37-26(31)32/h3-12,20-21,26H,13H2,1-2H3.
What are the key properties of CID 171643848?
CID 171643848 has a molecular weight of 520.89 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171643848 is sourced from PubChem (CID 171643848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).