C32H32N3OP — CID 178039156
18-cyclopropyl-12-methyl-5-[4-(1-methylcyclobutyl)-3-phosphanylphenyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one (PubChem CID 178039156) has the molecular formula C32H32N3OP and a molecular weight of 505.60 g/mol. Its IUPAC name is 18-cyclopropyl-12-methyl-5-[4-(1-methylcyclobutyl)-3-phosphanylphenyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one.
| Compound Name | 18-cyclopropyl-12-methyl-5-[4-(1-methylcyclobutyl)-3-phosphanylphenyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
|---|---|
| PubChem CID | 178039156 |
| Molecular Formula | C32H32N3OP |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 18-cyclopropyl-12-methyl-5-[4-(1-methylcyclobutyl)-3-phosphanylphenyl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
| SMILES | CN1C(=O)c2cccc(C3CC3)c2C2CC1c1nc3ccc(-c4ccc(C5(C)CCC5)c(P)c4)cc3n12 |
| InChI | InChI=1S/C32H32N3OP/c1-32(13-4-14-32)23-11-9-20(16-28(23)37)19-10-12-24-25(15-19)35-26-17-27(30(35)33-24)34(2)31(36)22-6-3-5-21(29(22)26)18-7-8-18/h3,5-6,9-12,15-16,18,26-27H,4,7-8,13-14,17,37H2,1-2H3 |
| InChIKey | VDYVWTAVPKXZFY-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|