C29H26N8O2 — CID 178039104
(1R,11R)-5-[2-(1-azido-3-hydroxycyclobutyl)pyrimidin-5-yl]-18-cyclopropyl-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one (PubChem CID 178039104) has the molecular formula C29H26N8O2 and a molecular weight of 518.58 g/mol. Its IUPAC name is (1R,11R)-5-[2-(1-azido-3-hydroxycyclobutyl)pyrimidin-5-yl]-18-cyclopropyl-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one.
| Compound Name | (1R,11R)-5-[2-(1-azido-3-hydroxycyclobutyl)pyrimidin-5-yl]-18-cyclopropyl-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
|---|---|
| PubChem CID | 178039104 |
| Molecular Formula | C29H26N8O2 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | (1R,11R)-5-[2-(1-azido-3-hydroxycyclobutyl)pyrimidin-5-yl]-18-cyclopropyl-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
| SMILES | CN1C(=O)c2cccc(C3CC3)c2[C@H]2C[C@@H]1c1nc3ccc(-c4cnc(C5(N=[N+]=[N-])CC(O)C5)nc4)cc3n12 |
| InChI | InChI=1S/C29H26N8O2/c1-36-24-10-23(25-19(15-5-6-15)3-2-4-20(25)27(36)39)37-22-9-16(7-8-21(22)33-26(24)37)17-13-31-28(32-14-17)29(34-35-30)11-18(38)12-29/h2-4,7-9,13-15,18,23-24,38H,5-6,10-12H2,1H3/t18?,23-,24-,29?/m1/s1 |
| InChIKey | BFHYWBGWEJKXES-HVWVVBJJSA-N |
| XLogP | 5.15 |
| TPSA | 132.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|