C27H25N5O2 — CID 178039369
(1R,11R)-18-cyclopropyl-5-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one (PubChem CID 178039369) has the molecular formula C27H25N5O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is (1R,11R)-18-cyclopropyl-5-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one.
| Compound Name | (1R,11R)-18-cyclopropyl-5-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
|---|---|
| PubChem CID | 178039369 |
| Molecular Formula | C27H25N5O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (1R,11R)-18-cyclopropyl-5-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
| SMILES | CC(C)(O)c1ncc(-c2ccc3nc4n(c3c2)[C@@H]2C[C@H]4NC(=O)c3cccc(C4CC4)c32)cn1 |
| InChI | InChI=1S/C27H25N5O2/c1-27(2,34)26-28-12-16(13-29-26)15-8-9-19-21(10-15)32-22-11-20(24(32)30-19)31-25(33)18-5-3-4-17(23(18)22)14-6-7-14/h3-5,8-10,12-14,20,22,34H,6-7,11H2,1-2H3,(H,31,33)/t20-,22-/m1/s1 |
| InChIKey | UTOKRJPAMRKABM-IFMALSPDSA-N |
| XLogP | 4.38 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |