C22H15F2N5O3 — CID 121256552
(1R,11R)-18-(difluoromethoxy)-5-(2-oxo-1H-pyrimidin-5-yl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 121256552) has the molecular formula C22H15F2N5O3 and a molecular weight of 435.39 g/mol. Its IUPAC name is (1R,11R)-18-(difluoromethoxy)-5-(2-oxo-1H-pyrimidin-5-yl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11R)-18-(difluoromethoxy)-5-(2-oxo-1H-pyrimidin-5-yl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 121256552 |
| Molecular Formula | C22H15F2N5O3 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (1R,11R)-18-(difluoromethoxy)-5-(2-oxo-1H-pyrimidin-5-yl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | O=C1N[C@@H]2C[C@H](c3c(OC(F)F)cccc31)n1c2nc2ccc(-c3cnc(=O)[nH]c3)cc21 |
| InChI | InChI=1S/C22H15F2N5O3/c23-21(24)32-17-3-1-2-12-18(17)16-7-14(28-20(12)30)19-27-13-5-4-10(6-15(13)29(16)19)11-8-25-22(31)26-9-11/h1-6,8-9,14,16,21H,7H2,(H,28,30)(H,25,26,31)/t14-,16-/m1/s1 |
| InChIKey | VFOLRJYYUQLPHE-GDBMZVCRSA-N |
| XLogP | 3.17 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |