C26H22ClFN5P — CID 178024809
N'-[18-chloro-5-(4-dimethylphosphanyl-3-fluorophenyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,12,14(19),15,17-octaen-13-yl]methanimidamide (PubChem CID 178024809) has the molecular formula C26H22ClFN5P and a molecular weight of 489.92 g/mol. Its IUPAC name is N'-[18-chloro-5-(4-dimethylphosphanyl-3-fluorophenyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,12,14(19),15,17-octaen-13-yl]methanimidamide.
| Compound Name | N'-[18-chloro-5-(4-dimethylphosphanyl-3-fluorophenyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,12,14(19),15,17-octaen-13-yl]methanimidamide |
|---|---|
| PubChem CID | 178024809 |
| Molecular Formula | C26H22ClFN5P |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | N'-[18-chloro-5-(4-dimethylphosphanyl-3-fluorophenyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,12,14(19),15,17-octaen-13-yl]methanimidamide |
| SMILES | CP(C)c1ccc(-c2ccc3nc4n(c3c2)C2CC4N=C(/N=C/N)c3cccc(Cl)c32)cc1F |
| InChI | InChI=1S/C26H22ClFN5P/c1-34(2)23-9-7-14(10-18(23)28)15-6-8-19-21(11-15)33-22-12-20(26(33)32-19)31-25(30-13-29)16-4-3-5-17(27)24(16)22/h3-11,13,20,22H,12H2,1-2H3,(H2,29,30,31) |
| InChIKey | UZSQWSITDNWSFI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 68.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|